C24H16ClNO5 — CID 142659013
3-(1,3-benzodioxol-5-ylmethylamino)-4-(4-chloro-2-phenoxyphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 142659013) has the molecular formula C24H16ClNO5 and a molecular weight of 433.85 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylamino)-4-(4-chloro-2-phenoxyphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylamino)-4-(4-chloro-2-phenoxyphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142659013 |
| Molecular Formula | C24H16ClNO5 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylamino)-4-(4-chloro-2-phenoxyphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2ccc3c(c2)OCO3)c(-c2ccc(Cl)cc2Oc2ccccc2)c1=O |
| InChI | InChI=1S/C24H16ClNO5/c25-15-7-8-17(19(11-15)31-16-4-2-1-3-5-16)21-22(24(28)23(21)27)26-12-14-6-9-18-20(10-14)30-13-29-18/h1-11,26H,12-13H2 |
| InChIKey | MZFUCCUOJQONAZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|