C15H12FNO4 — CID 62905244
2-(1,3-benzodioxol-5-ylmethylamino)-3-fluorobenzoic acid (PubChem CID 62905244) has the molecular formula C15H12FNO4 and a molecular weight of 289.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-3-fluorobenzoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 62905244 |
| Molecular Formula | C15H12FNO4 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-3-fluorobenzoic acid |
| SMILES | O=C(O)c1cccc(F)c1NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12FNO4/c16-11-3-1-2-10(15(18)19)14(11)17-7-9-4-5-12-13(6-9)21-8-20-12/h1-6,17H,7-8H2,(H,18,19) |
| InChIKey | SYFBILOGDBPXJN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |