C22H18FN3O3S — CID 15955548
N-[4-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)phenyl]-2-fluorobenzamide (PubChem CID 15955548) has the molecular formula C22H18FN3O3S and a molecular weight of 423.47 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 15955548 |
| Molecular Formula | C22H18FN3O3S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)phenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(NC(=S)NCc2ccc3c(c2)OCO3)cc1)c1ccccc1F |
| InChI | InChI=1S/C22H18FN3O3S/c23-18-4-2-1-3-17(18)21(27)25-15-6-8-16(9-7-15)26-22(30)24-12-14-5-10-19-20(11-14)29-13-28-19/h1-11H,12-13H2,(H,25,27)(H2,24,26,30) |
| InChIKey | XCFJHUUAFAFTND-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|