C16H14FN3O2S — CID 9213336
1-(1,3-benzodioxol-5-ylmethyl)-3-[(Z)-(2-fluorophenyl)methylideneamino]thiourea (PubChem CID 9213336) has the molecular formula C16H14FN3O2S and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(Z)-(2-fluorophenyl)methylideneamino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(Z)-(2-fluorophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 9213336 |
| Molecular Formula | C16H14FN3O2S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(Z)-(2-fluorophenyl)methylideneamino]thiourea |
| SMILES | Fc1ccccc1/C=N\NC(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14FN3O2S/c17-13-4-2-1-3-12(13)9-19-20-16(23)18-8-11-5-6-14-15(7-11)22-10-21-14/h1-7,9H,8,10H2,(H2,18,20,23)/b19-9- |
| InChIKey | QNWIQSDORVNZIE-OCKHKDLRSA-N |
| XLogP | 2.55 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|