C16H13Cl2N3O3S — CID 135577065
1-(1,3-benzodioxol-5-ylmethyl)-3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]thiourea (PubChem CID 135577065) has the molecular formula C16H13Cl2N3O3S and a molecular weight of 398.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135577065 |
| Molecular Formula | C16H13Cl2N3O3S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]thiourea |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/NC(=S)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13Cl2N3O3S/c17-11-4-10(15(22)12(18)5-11)7-20-21-16(25)19-6-9-1-2-13-14(3-9)24-8-23-13/h1-5,7,22H,6,8H2,(H2,19,21,25)/b20-7+ |
| InChIKey | YQPLYYGFSMTJHC-IFRROFPPSA-N |
| XLogP | 3.43 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|