C17H13Cl2N3O4 — CID 8896575
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxamide (PubChem CID 8896575) has the molecular formula C17H13Cl2N3O4 and a molecular weight of 394.21 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 8896575 |
| Molecular Formula | C17H13Cl2N3O4 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]oxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(=O)N/N=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H13Cl2N3O4/c18-12-2-1-3-13(19)11(12)8-21-22-17(24)16(23)20-7-10-4-5-14-15(6-10)26-9-25-14/h1-6,8H,7,9H2,(H,20,23)(H,22,24)/b21-8- |
| InChIKey | FAZVZCPLZGBBEF-WNFQYIGGSA-N |
| XLogP | 2.49 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|