C20H21N3O7 — CID 3127479
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]oxamide (PubChem CID 3127479) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 3127479 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(3,4,5-trimethoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)NCc2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N3O7/c1-26-16-7-13(8-17(27-2)18(16)28-3)10-22-23-20(25)19(24)21-9-12-4-5-14-15(6-12)30-11-29-14/h4-8,10H,9,11H2,1-3H3,(H,21,24)(H,23,25) |
| InChIKey | FEUUKHARIHALQO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|