C27H26N4O8 — CID 126163933
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126163933) has the molecular formula C27H26N4O8 and a molecular weight of 534.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126163933 |
| Molecular Formula | C27H26N4O8 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | COc1cccc(NC(=O)COc2ccc(/C=N\NC(=O)C(=O)NCc3ccc4c(c3)OCO4)cc2OC)c1 |
| InChI | InChI=1S/C27H26N4O8/c1-35-20-5-3-4-19(12-20)30-25(32)15-37-21-8-7-18(10-23(21)36-2)14-29-31-27(34)26(33)28-13-17-6-9-22-24(11-17)39-16-38-22/h3-12,14H,13,15-16H2,1-2H3,(H,28,33)(H,30,32)(H,31,34)/b29-14- |
| InChIKey | WBRHOXVWYLZHOF-NUJZUDFISA-N |
| XLogP | 2.22 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|