C24H24N4O7 — CID 126258731
N-(furan-2-ylmethyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126258731) has the molecular formula C24H24N4O7 and a molecular weight of 480.48 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126258731 |
| Molecular Formula | C24H24N4O7 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | COc1cccc(NC(=O)COc2ccc(/C=N\NC(=O)C(=O)NCc3ccco3)cc2OC)c1 |
| InChI | InChI=1S/C24H24N4O7/c1-32-18-6-3-5-17(12-18)27-22(29)15-35-20-9-8-16(11-21(20)33-2)13-26-28-24(31)23(30)25-14-19-7-4-10-34-19/h3-13H,14-15H2,1-2H3,(H,25,30)(H,27,29)(H,28,31)/b26-13- |
| InChIKey | CIAQVNASRMLDEG-ZMFRSBBQSA-N |
| XLogP | 2.08 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|