C24H22Cl2N4O6 — CID 126270056
N'-[(Z)-[4-[2-(2,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 126270056) has the molecular formula C24H22Cl2N4O6 and a molecular weight of 533.37 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(2,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(2,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 126270056 |
| Molecular Formula | C24H22Cl2N4O6 |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | N'-[(Z)-[4-[2-(2,4-dichloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCc2ccco2)ccc1OCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N4O6/c1-2-34-21-10-15(12-28-30-24(33)23(32)27-13-17-4-3-9-35-17)5-8-20(21)36-14-22(31)29-19-7-6-16(25)11-18(19)26/h3-12H,2,13-14H2,1H3,(H,27,32)(H,29,31)(H,30,33)/b28-12- |
| InChIKey | JHTURWWXJDHSKL-NVJOKUIPSA-N |
| XLogP | 3.77 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|