C24H22BrIN4O6 — CID 126159128
N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 126159128) has the molecular formula C24H22BrIN4O6 and a molecular weight of 669.27 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 126159128 |
| Molecular Formula | C24H22BrIN4O6 |
| Molecular Weight | 669.27 g/mol |
| Exact Mass | 667.98 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCc2ccco2)cc(I)c1OCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H22BrIN4O6/c1-2-34-20-11-15(12-28-30-24(33)23(32)27-13-18-4-3-9-35-18)10-19(26)22(20)36-14-21(31)29-17-7-5-16(25)6-8-17/h3-12H,2,13-14H2,1H3,(H,27,32)(H,29,31)(H,30,33)/b28-12- |
| InChIKey | GIKDXEYBQVZTHF-NVJOKUIPSA-N |
| XLogP | 3.83 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|