C23H20BrIN4O6 — CID 126161367
N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 126161367) has the molecular formula C23H20BrIN4O6 and a molecular weight of 655.24 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 126161367 |
| Molecular Formula | C23H20BrIN4O6 |
| Molecular Weight | 655.24 g/mol |
| Exact Mass | 653.96 |
| IUPAC Name | N'-[(Z)-[4-[2-(4-bromoanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NCc2ccco2)cc(I)c1OCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H20BrIN4O6/c1-33-19-10-14(11-27-29-23(32)22(31)26-12-17-3-2-8-34-17)9-18(25)21(19)35-13-20(30)28-16-6-4-15(24)5-7-16/h2-11H,12-13H2,1H3,(H,26,31)(H,28,30)(H,29,32)/b27-11- |
| InChIKey | LOYAPFOVMYAGBE-BCHBDCPOSA-N |
| XLogP | 3.44 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|