C16H16BrN3O5 — CID 8900540
N'-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 8900540) has the molecular formula C16H16BrN3O5 and a molecular weight of 410.22 g/mol. Its IUPAC name is N'-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 8900540 |
| Molecular Formula | C16H16BrN3O5 |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N'-[(Z)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NCc2ccco2)cc(Br)c1OC |
| InChI | InChI=1S/C16H16BrN3O5/c1-23-13-7-10(6-12(17)14(13)24-2)8-19-20-16(22)15(21)18-9-11-4-3-5-25-11/h3-8H,9H2,1-2H3,(H,18,21)(H,20,22)/b19-8- |
| InChIKey | AUGLWNKTRFBVJV-UWVJOHFNSA-N |
| XLogP | 1.83 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|