C16H14ClF2N3O5 — CID 9352968
N'-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 9352968) has the molecular formula C16H14ClF2N3O5 and a molecular weight of 401.75 g/mol. Its IUPAC name is N'-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 9352968 |
| Molecular Formula | C16H14ClF2N3O5 |
| Molecular Weight | 401.75 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N'-[(Z)-[3-chloro-4-(difluoromethoxy)-5-methoxyphenyl]methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NCc2ccco2)cc(Cl)c1OC(F)F |
| InChI | InChI=1S/C16H14ClF2N3O5/c1-25-12-6-9(5-11(17)13(12)27-16(18)19)7-21-22-15(24)14(23)20-8-10-3-2-4-26-10/h2-7,16H,8H2,1H3,(H,20,23)(H,22,24)/b21-7- |
| InChIKey | LDYOBMKMHYOORI-YXSASFKJSA-N |
| XLogP | 2.31 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|