C15H19F2N3O5 — CID 9352006
N'-[(Z)-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylideneamino]-N-propan-2-yloxamide (PubChem CID 9352006) has the molecular formula C15H19F2N3O5 and a molecular weight of 359.33 g/mol. Its IUPAC name is N'-[(Z)-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylideneamino]-N-propan-2-yloxamide.
| Compound Name | N'-[(Z)-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylideneamino]-N-propan-2-yloxamide |
|---|---|
| PubChem CID | 9352006 |
| Molecular Formula | C15H19F2N3O5 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N'-[(Z)-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]methylideneamino]-N-propan-2-yloxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NC(C)C)cc(OC)c1OC(F)F |
| InChI | InChI=1S/C15H19F2N3O5/c1-8(2)19-13(21)14(22)20-18-7-9-5-10(23-3)12(25-15(16)17)11(6-9)24-4/h5-8,15H,1-4H3,(H,19,21)(H,20,22)/b18-7- |
| InChIKey | VJTUBWKOFQMYSS-WSVATBPTSA-N |
| XLogP | 1.28 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|