C14H15Cl2N3O5 — CID 8990106
2-[2,6-dichloro-4-[(Z)-[[2-oxo-2-(propan-2-ylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 8990106) has the molecular formula C14H15Cl2N3O5 and a molecular weight of 376.20 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(Z)-[[2-oxo-2-(propan-2-ylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dichloro-4-[(Z)-[[2-oxo-2-(propan-2-ylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 8990106 |
| Molecular Formula | C14H15Cl2N3O5 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 2-[2,6-dichloro-4-[(Z)-[[2-oxo-2-(propan-2-ylamino)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CC(C)NC(=O)C(=O)N/N=C\c1cc(Cl)c(OCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2N3O5/c1-7(2)18-13(22)14(23)19-17-5-8-3-9(15)12(10(16)4-8)24-6-11(20)21/h3-5,7H,6H2,1-2H3,(H,18,22)(H,19,23)(H,20,21)/b17-5- |
| InChIKey | DZPXLCSDFIFUED-ZWSORDCHSA-N |
| XLogP | 1.43 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|