C18H25ClN4O5 — CID 9351925
N'-[(Z)-[3-chloro-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-propan-2-yloxamide (PubChem CID 9351925) has the molecular formula C18H25ClN4O5 and a molecular weight of 412.87 g/mol. Its IUPAC name is N'-[(Z)-[3-chloro-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-propan-2-yloxamide.
| Compound Name | N'-[(Z)-[3-chloro-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-propan-2-yloxamide |
|---|---|
| PubChem CID | 9351925 |
| Molecular Formula | C18H25ClN4O5 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N'-[(Z)-[3-chloro-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylideneamino]-N-propan-2-yloxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NC(C)C)cc(Cl)c1OCC(=O)N(C)C |
| InChI | InChI=1S/C18H25ClN4O5/c1-6-27-14-8-12(9-20-22-18(26)17(25)21-11(2)3)7-13(19)16(14)28-10-15(24)23(4)5/h7-9,11H,6,10H2,1-5H3,(H,21,25)(H,22,26)/b20-9- |
| InChIKey | IFEWLTRPXWUMDG-UKWGHVSLSA-N |
| XLogP | 1.18 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|