C15H21ClN2O3 — CID 126020491
N-[(Z)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-ethoxyphenyl]methylideneamino]acetamide (PubChem CID 126020491) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-[(Z)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-ethoxyphenyl]methylideneamino]acetamide.
| Compound Name | N-[(Z)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-ethoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126020491 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-[(Z)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-ethoxyphenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(C)=O)cc(Cl)c1O[C@H](C)CC |
| InChI | InChI=1S/C15H21ClN2O3/c1-5-10(3)21-15-13(16)7-12(8-14(15)20-6-2)9-17-18-11(4)19/h7-10H,5-6H2,1-4H3,(H,18,19)/b17-9-/t10-/m1/s1 |
| InChIKey | OJSXLBHWDZUIMF-LGQZLYSRSA-N |
| XLogP | 3.39 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|