C21H24ClFN2O3 — CID 126247020
N-[(E)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-ethoxyphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide (PubChem CID 126247020) has the molecular formula C21H24ClFN2O3 and a molecular weight of 406.89 g/mol. Its IUPAC name is N-[(E)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-ethoxyphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(E)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-ethoxyphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126247020 |
| Molecular Formula | C21H24ClFN2O3 |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[(E)-[4-[(2R)-butan-2-yl]oxy-3-chloro-5-ethoxyphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccc(F)cc2)cc(Cl)c1O[C@H](C)CC |
| InChI | InChI=1S/C21H24ClFN2O3/c1-4-14(3)28-21-18(22)10-16(11-19(21)27-5-2)13-24-25-20(26)12-15-6-8-17(23)9-7-15/h6-11,13-14H,4-5,12H2,1-3H3,(H,25,26)/b24-13+/t14-/m1/s1 |
| InChIKey | QCIMGMIGXJOQMF-FIKYGGOLSA-N |
| XLogP | 4.75 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|