C24H20BrCl2FN2O3 — CID 126251896
N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide (PubChem CID 126251896) has the molecular formula C24H20BrCl2FN2O3 and a molecular weight of 554.24 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126251896 |
| Molecular Formula | C24H20BrCl2FN2O3 |
| Molecular Weight | 554.24 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccc(F)cc2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H20BrCl2FN2O3/c1-2-32-22-10-16(13-29-30-23(31)11-15-3-7-19(28)8-4-15)9-20(25)24(22)33-14-17-5-6-18(26)12-21(17)27/h3-10,12-13H,2,11,14H2,1H3,(H,30,31)/b29-13+ |
| InChIKey | YCKMGRCMCMANOK-VFLNYLIXSA-N |
| XLogP | 6.57 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.24 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|