C22H24BrCl2N3O4 — CID 126001303
N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 126001303) has the molecular formula C22H24BrCl2N3O4 and a molecular weight of 545.26 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 126001303 |
| Molecular Formula | C22H24BrCl2N3O4 |
| Molecular Weight | 545.26 g/mol |
| Exact Mass | 543.03 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CN2CCOCC2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H24BrCl2N3O4/c1-2-31-20-10-15(12-26-27-21(29)13-28-5-7-30-8-6-28)9-18(23)22(20)32-14-16-3-4-17(24)11-19(16)25/h3-4,9-12H,2,5-8,13-14H2,1H3,(H,27,29)/b26-12+ |
| InChIKey | IKYGCXAFDIGNMF-RPPGKUMJSA-N |
| XLogP | 4.52 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|