C20H21BrClN3O3 — CID 26368175
N-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 26368175) has the molecular formula C20H21BrClN3O3 and a molecular weight of 466.76 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 26368175 |
| Molecular Formula | C20H21BrClN3O3 |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)N/N=C\c1ccc(OCc2ccccc2Cl)c(Br)c1 |
| InChI | InChI=1S/C20H21BrClN3O3/c21-17-11-15(12-23-24-20(26)13-25-7-9-27-10-8-25)5-6-19(17)28-14-16-3-1-2-4-18(16)22/h1-6,11-12H,7-10,13-14H2,(H,24,26)/b23-12- |
| InChIKey | JXFPSZGRWISBEC-FMCGGJTJSA-N |
| XLogP | 3.46 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|