C28H31ClN4O3 — CID 6159492
2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-N-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 6159492) has the molecular formula C28H31ClN4O3 and a molecular weight of 507.03 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-N-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-N-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6159492 |
| Molecular Formula | C28H31ClN4O3 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-N-[(Z)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)CN2CCN(Cc3ccccc3Cl)CC2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C28H31ClN4O3/c1-35-26-12-11-23(17-27(26)36-21-22-7-3-2-4-8-22)18-30-31-28(34)20-33-15-13-32(14-16-33)19-24-9-5-6-10-25(24)29/h2-12,17-18H,13-16,19-21H2,1H3,(H,31,34)/b30-18- |
| InChIKey | BGNSVWZMKUUDSJ-YKQZZPSBSA-N |
| XLogP | 4.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|