C24H22Cl2N2O3S — CID 126130888
2-[(2,6-dichlorophenyl)methylsulfanyl]-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 126130888) has the molecular formula C24H22Cl2N2O3S and a molecular weight of 489.42 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126130888 |
| Molecular Formula | C24H22Cl2N2O3S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CSCc2c(Cl)cccc2Cl)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H22Cl2N2O3S/c1-30-23-12-18(10-11-22(23)31-14-17-6-3-2-4-7-17)13-27-28-24(29)16-32-15-19-20(25)8-5-9-21(19)26/h2-13H,14-16H2,1H3,(H,28,29)/b27-13- |
| InChIKey | BQTDZXMAVSVQIX-WKIKZPBSSA-N |
| XLogP | 5.96 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|