C25H22Cl4N2O3S — CID 126125307
N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide (PubChem CID 126125307) has the molecular formula C25H22Cl4N2O3S and a molecular weight of 572.34 g/mol. Its IUPAC name is N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 126125307 |
| Molecular Formula | C25H22Cl4N2O3S |
| Molecular Weight | 572.34 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-[(2,6-dichlorophenyl)methylsulfanyl]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CSCc2c(Cl)cccc2Cl)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H22Cl4N2O3S/c1-2-33-24-10-16(6-9-23(24)34-13-17-7-8-18(26)11-22(17)29)12-30-31-25(32)15-35-14-19-20(27)4-3-5-21(19)28/h3-12H,2,13-15H2,1H3,(H,31,32)/b30-12- |
| InChIKey | QXGDCPCCJRYCKE-FTCYSYDXSA-N |
| XLogP | 7.66 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.34 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|