C25H21Cl4N3O4 — CID 3914835
N-(2,3-dichlorophenyl)-N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]propanediamide (PubChem CID 3914835) has the molecular formula C25H21Cl4N3O4 and a molecular weight of 569.27 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]propanediamide.
| Compound Name | N-(2,3-dichlorophenyl)-N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 3914835 |
| Molecular Formula | C25H21Cl4N3O4 |
| Molecular Weight | 569.27 g/mol |
| Exact Mass | 567.03 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]propanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CC(=O)Nc2cccc(Cl)c2Cl)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H21Cl4N3O4/c1-2-35-22-10-15(6-9-21(22)36-14-16-7-8-17(26)11-19(16)28)13-30-32-24(34)12-23(33)31-20-5-3-4-18(27)25(20)29/h3-11,13H,2,12,14H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | ZXWAJOZNBXVACJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.27 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|