C25H26ClN3O4 — CID 126006365
N-[(E)-[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 126006365) has the molecular formula C25H26ClN3O4 and a molecular weight of 467.95 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 126006365 |
| Molecular Formula | C25H26ClN3O4 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-[(E)-[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | COc1cc(/C=N/NC(=O)CN2CCOCC2)cc(Cl)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C25H26ClN3O4/c1-31-23-14-18(15-27-28-24(30)16-29-9-11-32-12-10-29)13-22(26)25(23)33-17-20-7-4-6-19-5-2-3-8-21(19)20/h2-8,13-15H,9-12,16-17H2,1H3,(H,28,30)/b27-15+ |
| InChIKey | SHRWXXXQRDSGOD-JFLMPSFJSA-N |
| XLogP | 3.86 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|