C23H19Cl3N2O3S — CID 126218836
N-[(Z)-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-chlorophenyl)sulfanylacetamide (PubChem CID 126218836) has the molecular formula C23H19Cl3N2O3S and a molecular weight of 509.84 g/mol. Its IUPAC name is N-[(Z)-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-chlorophenyl)sulfanylacetamide.
| Compound Name | N-[(Z)-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-chlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 126218836 |
| Molecular Formula | C23H19Cl3N2O3S |
| Molecular Weight | 509.84 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | N-[(Z)-[3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-chlorophenyl)sulfanylacetamide |
| SMILES | COc1cc(/C=N\NC(=O)CSc2ccc(Cl)cc2)cc(Cl)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C23H19Cl3N2O3S/c1-30-21-11-15(10-20(26)23(21)31-13-16-4-2-3-5-19(16)25)12-27-28-22(29)14-32-18-8-6-17(24)7-9-18/h2-12H,13-14H2,1H3,(H,28,29)/b27-12- |
| InChIKey | RBEKFJCLMIWQGC-PPDIBHTLSA-N |
| XLogP | 6.48 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.84 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|