C19H18ClIN2O5S — CID 126216386
methyl 2-[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 126216386) has the molecular formula C19H18ClIN2O5S and a molecular weight of 548.79 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126216386 |
| Molecular Formula | C19H18ClIN2O5S |
| Molecular Weight | 548.79 g/mol |
| Exact Mass | 547.97 |
| IUPAC Name | methyl 2-[4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=N\NC(=O)CSc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C19H18ClIN2O5S/c1-26-16-8-12(7-15(21)19(16)28-10-18(25)27-2)9-22-23-17(24)11-29-14-5-3-13(20)4-6-14/h3-9H,10-11H2,1-2H3,(H,23,24)/b22-9- |
| InChIKey | FJECKWMAYDJGDL-AFPJDJCSSA-N |
| XLogP | 3.75 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.79 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|