C20H23IN4O5S — CID 126252264
ethyl 2-[4-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 126252264) has the molecular formula C20H23IN4O5S and a molecular weight of 558.40 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126252264 |
| Molecular Formula | C20H23IN4O5S |
| Molecular Weight | 558.40 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | ethyl 2-[4-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=N\NC(=O)CSc2nc(C)cc(C)n2)cc1OC |
| InChI | InChI=1S/C20H23IN4O5S/c1-5-29-18(27)10-30-19-15(21)7-14(8-16(19)28-4)9-22-25-17(26)11-31-20-23-12(2)6-13(3)24-20/h6-9H,5,10-11H2,1-4H3,(H,25,26)/b22-9- |
| InChIKey | DQTXZQDDSAJDLS-AFPJDJCSSA-N |
| XLogP | 2.89 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|