C20H25IN4O3S — CID 126239849
N-[(Z)-[4-[(2S)-butan-2-yl]oxy-3-iodo-5-methoxyphenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 126239849) has the molecular formula C20H25IN4O3S and a molecular weight of 528.42 g/mol. Its IUPAC name is N-[(Z)-[4-[(2S)-butan-2-yl]oxy-3-iodo-5-methoxyphenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-[4-[(2S)-butan-2-yl]oxy-3-iodo-5-methoxyphenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 126239849 |
| Molecular Formula | C20H25IN4O3S |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | N-[(Z)-[4-[(2S)-butan-2-yl]oxy-3-iodo-5-methoxyphenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | CC[C@H](C)Oc1c(I)cc(/C=N\NC(=O)CSc2nc(C)cc(C)n2)cc1OC |
| InChI | InChI=1S/C20H25IN4O3S/c1-6-14(4)28-19-16(21)8-15(9-17(19)27-5)10-22-25-18(26)11-29-20-23-12(2)7-13(3)24-20/h7-10,14H,6,11H2,1-5H3,(H,25,26)/b22-10-/t14-/m0/s1 |
| InChIKey | HBWILYNHMVKWEE-ISNLTARASA-N |
| XLogP | 4.13 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|