C23H22I2N4O3S — CID 126238852
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-iodo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide (PubChem CID 126238852) has the molecular formula C23H22I2N4O3S and a molecular weight of 688.33 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-iodo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-iodo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126238852 |
| Molecular Formula | C23H22I2N4O3S |
| Molecular Weight | 688.33 g/mol |
| Exact Mass | 687.95 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-[(Z)-[3-iodo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CSc2nc(C)cc(C)n2)cc(I)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C23H22I2N4O3S/c1-14-8-15(2)28-23(27-14)33-13-21(30)29-26-11-17-9-19(25)22(20(10-17)31-3)32-12-16-4-6-18(24)7-5-16/h4-11H,12-13H2,1-3H3,(H,29,30)/b26-11- |
| InChIKey | AZZLWOSRNZPJJR-RAWMCFOBSA-N |
| XLogP | 5.13 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|