C27H25ClN4O3S — CID 126236676
N-[(Z)-[3-chloro-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 126236676) has the molecular formula C27H25ClN4O3S and a molecular weight of 521.04 g/mol. Its IUPAC name is N-[(Z)-[3-chloro-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-[3-chloro-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 126236676 |
| Molecular Formula | C27H25ClN4O3S |
| Molecular Weight | 521.04 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | N-[(Z)-[3-chloro-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | COc1cc(/C=N\NC(=O)CSc2nc(C)cc(C)n2)cc(Cl)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H25ClN4O3S/c1-17-10-18(2)31-27(30-17)36-16-25(33)32-29-14-20-12-23(28)26(24(13-20)34-3)35-15-19-8-9-21-6-4-5-7-22(21)11-19/h4-14H,15-16H2,1-3H3,(H,32,33)/b29-14- |
| InChIKey | YTYZBPFCAVCRBP-NUJZUDFISA-N |
| XLogP | 5.73 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.04 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|