C19H20Cl2N4O4S — CID 126237121
ethyl 2-[2,6-dichloro-4-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126237121) has the molecular formula C19H20Cl2N4O4S and a molecular weight of 471.37 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-4-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-4-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126237121 |
| Molecular Formula | C19H20Cl2N4O4S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | ethyl 2-[2,6-dichloro-4-[(Z)-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=N\NC(=O)CSc2nc(C)cc(C)n2)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N4O4S/c1-4-28-17(27)9-29-18-14(20)6-13(7-15(18)21)8-22-25-16(26)10-30-19-23-11(2)5-12(3)24-19/h5-8H,4,9-10H2,1-3H3,(H,25,26)/b22-8- |
| InChIKey | HAHZMZBHJWZXRR-UYOCIXKTSA-N |
| XLogP | 3.58 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|