C19H17Br2ClN2O4S — CID 126206847
ethyl 2-[2,6-dibromo-4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126206847) has the molecular formula C19H17Br2ClN2O4S and a molecular weight of 564.68 g/mol. Its IUPAC name is ethyl 2-[2,6-dibromo-4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dibromo-4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126206847 |
| Molecular Formula | C19H17Br2ClN2O4S |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 561.90 |
| IUPAC Name | ethyl 2-[2,6-dibromo-4-[(Z)-[[2-(4-chlorophenyl)sulfanylacetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=N\NC(=O)CSc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C19H17Br2ClN2O4S/c1-2-27-18(26)10-28-19-15(20)7-12(8-16(19)21)9-23-24-17(25)11-29-14-5-3-13(22)4-6-14/h3-9H,2,10-11H2,1H3,(H,24,25)/b23-9- |
| InChIKey | IYZBTOUFKUODJS-AQHIEDMUSA-N |
| XLogP | 5.05 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|