C17H15ClI2N2O2S — CID 126215637
2-(4-chlorophenyl)sulfanyl-N-[(Z)-(4-ethoxy-3,5-diiodophenyl)methylideneamino]acetamide (PubChem CID 126215637) has the molecular formula C17H15ClI2N2O2S and a molecular weight of 600.65 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(Z)-(4-ethoxy-3,5-diiodophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-(4-ethoxy-3,5-diiodophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126215637 |
| Molecular Formula | C17H15ClI2N2O2S |
| Molecular Weight | 600.65 g/mol |
| Exact Mass | 599.86 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-(4-ethoxy-3,5-diiodophenyl)methylideneamino]acetamide |
| SMILES | CCOc1c(I)cc(/C=N\NC(=O)CSc2ccc(Cl)cc2)cc1I |
| InChI | InChI=1S/C17H15ClI2N2O2S/c1-2-24-17-14(19)7-11(8-15(17)20)9-21-22-16(23)10-25-13-5-3-12(18)4-6-13/h3-9H,2,10H2,1H3,(H,22,23)/b21-9- |
| InChIKey | GXDYIQRNZGFLDA-NKVSQWTQSA-N |
| XLogP | 5.19 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|