C27H25Cl3N2O3S — CID 126223270
2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]acetamide (PubChem CID 126223270) has the molecular formula C27H25Cl3N2O3S and a molecular weight of 563.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126223270 |
| Molecular Formula | C27H25Cl3N2O3S |
| Molecular Weight | 563.93 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]acetamide |
| SMILES | C=CCc1cc(/C=N\NC(=O)CSc2ccc(Cl)cc2)cc(OCC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H25Cl3N2O3S/c1-3-5-19-12-18(15-31-32-26(33)17-36-23-10-8-21(28)9-11-23)13-25(34-4-2)27(19)35-16-20-6-7-22(29)14-24(20)30/h3,6-15H,1,4-5,16-17H2,2H3,(H,32,33)/b31-15- |
| InChIKey | RGFMYHZKGYYSEA-BVMLUPFRSA-N |
| XLogP | 7.60 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.93 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|