C28H29ClN2O3S — CID 126214291
2-(4-chlorophenyl)sulfanyl-N-[(Z)-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]acetamide (PubChem CID 126214291) has the molecular formula C28H29ClN2O3S and a molecular weight of 509.07 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126214291 |
| Molecular Formula | C28H29ClN2O3S |
| Molecular Weight | 509.07 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[3-ethoxy-4-[(4-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]acetamide |
| SMILES | C=CCc1cc(/C=N\NC(=O)CSc2ccc(Cl)cc2)cc(OCC)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C28H29ClN2O3S/c1-4-6-23-15-22(17-30-31-27(32)19-35-25-13-11-24(29)12-14-25)16-26(33-5-2)28(23)34-18-21-9-7-20(3)8-10-21/h4,7-17H,1,5-6,18-19H2,2-3H3,(H,31,32)/b30-17- |
| InChIKey | ASBIOMWHSZUHSB-LQNQUEJISA-N |
| XLogP | 6.60 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.07 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|