C27H26ClFN2O3 — CID 126238706
N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide (PubChem CID 126238706) has the molecular formula C27H26ClFN2O3 and a molecular weight of 480.97 g/mol. Its IUPAC name is N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126238706 |
| Molecular Formula | C27H26ClFN2O3 |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-2-(4-fluorophenyl)acetamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)Cc2ccc(F)cc2)cc(OCC)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H26ClFN2O3/c1-3-5-22-14-21(17-30-31-26(32)16-19-8-12-24(29)13-9-19)15-25(33-4-2)27(22)34-18-20-6-10-23(28)11-7-20/h3,6-15,17H,1,4-5,16,18H2,2H3,(H,31,32)/b30-17+ |
| InChIKey | QMLUZCOOBJRNTD-OCSSWDANSA-N |
| XLogP | 5.88 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|