C25H22BrClN2O3 — CID 126197488
N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-4-chlorobenzamide (PubChem CID 126197488) has the molecular formula C25H22BrClN2O3 and a molecular weight of 513.82 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-4-chlorobenzamide.
| Compound Name | N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-4-chlorobenzamide |
|---|---|
| PubChem CID | 126197488 |
| Molecular Formula | C25H22BrClN2O3 |
| Molecular Weight | 513.82 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]-4-chlorobenzamide |
| SMILES | C=CCc1cc(/C=N\NC(=O)c2ccc(Cl)cc2)cc(OC)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H22BrClN2O3/c1-3-4-20-13-18(15-28-29-25(30)19-7-11-22(27)12-8-19)14-23(31-2)24(20)32-16-17-5-9-21(26)10-6-17/h3,5-15H,1,4,16H2,2H3,(H,29,30)/b28-15- |
| InChIKey | FMVGLKPMHDLKTQ-MBTHVWNTSA-N |
| XLogP | 6.18 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.82 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|