C25H24Br2N2O5 — CID 2370993
4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 2370993) has the molecular formula C25H24Br2N2O5 and a molecular weight of 592.28 g/mol. Its IUPAC name is 4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2370993 |
| Molecular Formula | C25H24Br2N2O5 |
| Molecular Weight | 592.28 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | 4-[(2,6-dibromo-4-methylphenoxy)methyl]-N-[(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(COc3c(Br)cc(C)cc3Br)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24Br2N2O5/c1-15-9-19(26)23(20(27)10-15)34-14-16-5-7-18(8-6-16)25(30)29-28-13-17-11-21(31-2)24(33-4)22(12-17)32-3/h5-13H,14H2,1-4H3,(H,29,30) |
| InChIKey | JAUSWRAZQWFBLJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.28 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|