C26H24ClFN2O3S — CID 126222799
2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]acetamide (PubChem CID 126222799) has the molecular formula C26H24ClFN2O3S and a molecular weight of 499.01 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126222799 |
| Molecular Formula | C26H24ClFN2O3S |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]acetamide |
| SMILES | C=CCc1cc(/C=N\NC(=O)CSc2ccc(Cl)cc2)cc(OC)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H24ClFN2O3S/c1-3-4-20-13-19(15-29-30-25(31)17-34-23-11-7-21(27)8-12-23)14-24(32-2)26(20)33-16-18-5-9-22(28)10-6-18/h3,5-15H,1,4,16-17H2,2H3,(H,30,31)/b29-15- |
| InChIKey | MRMMVAZRPMWRTH-FDVSRXAVSA-N |
| XLogP | 6.04 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|