C26H21F2N3O3 — CID 3953048
4-cyano-2-fluoro-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]benzamide (PubChem CID 3953048) has the molecular formula C26H21F2N3O3 and a molecular weight of 461.47 g/mol. Its IUPAC name is 4-cyano-2-fluoro-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]benzamide.
| Compound Name | 4-cyano-2-fluoro-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3953048 |
| Molecular Formula | C26H21F2N3O3 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 4-cyano-2-fluoro-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylideneamino]benzamide |
| SMILES | C=CCc1cc(C=NNC(=O)c2ccc(C#N)cc2F)cc(OC)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H21F2N3O3/c1-3-4-20-11-19(15-30-31-26(32)22-10-7-18(14-29)12-23(22)28)13-24(33-2)25(20)34-16-17-5-8-21(27)9-6-17/h3,5-13,15H,1,4,16H2,2H3,(H,31,32) |
| InChIKey | ZZQQEXOHYOMQAL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|