C26H16Cl2FN3O2 — CID 4013388
4-cyano-N-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-fluorobenzamide (PubChem CID 4013388) has the molecular formula C26H16Cl2FN3O2 and a molecular weight of 492.34 g/mol. Its IUPAC name is 4-cyano-N-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-fluorobenzamide.
| Compound Name | 4-cyano-N-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4013388 |
| Molecular Formula | C26H16Cl2FN3O2 |
| Molecular Weight | 492.34 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 4-cyano-N-[[3,5-dichloro-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-fluorobenzamide |
| SMILES | N#Cc1ccc(C(=O)NN=Cc2cc(Cl)c(OCc3cccc4ccccc34)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C26H16Cl2FN3O2/c27-22-10-17(14-31-32-26(33)21-9-8-16(13-30)12-24(21)29)11-23(28)25(22)34-15-19-6-3-5-18-4-1-2-7-20(18)19/h1-12,14H,15H2,(H,32,33) |
| InChIKey | RJPSOKGBLAUUSQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.34 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|