C22H13BrCl2FN3O2 — CID 3351476
N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-cyano-2-fluorobenzamide (PubChem CID 3351476) has the molecular formula C22H13BrCl2FN3O2 and a molecular weight of 521.17 g/mol. Its IUPAC name is N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-cyano-2-fluorobenzamide.
| Compound Name | N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-cyano-2-fluorobenzamide |
|---|---|
| PubChem CID | 3351476 |
| Molecular Formula | C22H13BrCl2FN3O2 |
| Molecular Weight | 521.17 g/mol |
| Exact Mass | 518.96 |
| IUPAC Name | N-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-cyano-2-fluorobenzamide |
| SMILES | N#Cc1ccc(C(=O)NN=Cc2cc(Br)ccc2OCc2ccc(Cl)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C22H13BrCl2FN3O2/c23-16-3-6-21(31-12-14-2-4-17(24)9-19(14)25)15(8-16)11-28-29-22(30)18-5-1-13(10-27)7-20(18)26/h1-9,11H,12H2,(H,29,30) |
| InChIKey | AOBLBOITLRYUEB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.17 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|