C26H23Cl3FN3O3 — CID 5202521
N-[1-[2-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide (PubChem CID 5202521) has the molecular formula C26H23Cl3FN3O3 and a molecular weight of 550.85 g/mol. Its IUPAC name is N-[1-[2-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[1-[2-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 5202521 |
| Molecular Formula | C26H23Cl3FN3O3 |
| Molecular Weight | 550.85 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | N-[1-[2-[[5-chloro-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2-fluorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1F)C(=O)NN=Cc1cc(Cl)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H23Cl3FN3O3/c1-15(2)24(32-25(34)20-5-3-4-6-22(20)30)26(35)33-31-13-17-11-18(27)9-10-23(17)36-14-16-7-8-19(28)12-21(16)29/h3-13,15,24H,14H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | IRTYHUFBJMYVDY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.85 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|