C26H24Cl3N3O3 — CID 3367369
2,4-dichloro-N-[1-[2-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3367369) has the molecular formula C26H24Cl3N3O3 and a molecular weight of 532.86 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[2-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[2-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3367369 |
| Molecular Formula | C26H24Cl3N3O3 |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 531.09 |
| IUPAC Name | 2,4-dichloro-N-[1-[2-[[4-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NN=Cc1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C26H24Cl3N3O3/c1-16(2)24(31-25(33)21-12-9-19(27)13-23(21)29)26(34)32-30-14-17-7-10-20(11-8-17)35-15-18-5-3-4-6-22(18)28/h3-14,16,24H,15H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | DOUHFDQGWAXBJW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|