C18H18Cl2N4O2 — CID 4277524
2,4-dichloro-N-[3-methyl-1-oxo-1-[2-(pyridin-4-ylmethylidene)hydrazinyl]butan-2-yl]benzamide (PubChem CID 4277524) has the molecular formula C18H18Cl2N4O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-methyl-1-oxo-1-[2-(pyridin-4-ylmethylidene)hydrazinyl]butan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-methyl-1-oxo-1-[2-(pyridin-4-ylmethylidene)hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 4277524 |
| Molecular Formula | C18H18Cl2N4O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2,4-dichloro-N-[3-methyl-1-oxo-1-[2-(pyridin-4-ylmethylidene)hydrazinyl]butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NN=Cc1ccncc1 |
| InChI | InChI=1S/C18H18Cl2N4O2/c1-11(2)16(18(26)24-22-10-12-5-7-21-8-6-12)23-17(25)14-4-3-13(19)9-15(14)20/h3-11,16H,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | NMDKAORFJCCLMS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|