C21H24Cl2N4O2 — CID 3483697
2,4-dichloro-N-[1-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3483697) has the molecular formula C21H24Cl2N4O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3483697 |
| Molecular Formula | C21H24Cl2N4O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2,4-dichloro-N-[1-[2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NN=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H24Cl2N4O2/c1-13(2)19(25-20(28)17-10-7-15(22)11-18(17)23)21(29)26-24-12-14-5-8-16(9-6-14)27(3)4/h5-13,19H,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | DPLCJFFYVIIICF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|