C19H18BrCl2N3O2 — CID 3661871
N-[1-[2-[(3-bromophenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide (PubChem CID 3661871) has the molecular formula C19H18BrCl2N3O2 and a molecular weight of 471.18 g/mol. Its IUPAC name is N-[1-[2-[(3-bromophenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[1-[2-[(3-bromophenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3661871 |
| Molecular Formula | C19H18BrCl2N3O2 |
| Molecular Weight | 471.18 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | N-[1-[2-[(3-bromophenyl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NN=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C19H18BrCl2N3O2/c1-11(2)17(24-18(26)15-7-6-14(21)9-16(15)22)19(27)25-23-10-12-4-3-5-13(20)8-12/h3-11,17H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | JAKYEFMNUSDVIN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.18 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|